C17H33BN2O2 — CID 163833541
methyl-[1-[2-(1-methylcyclohexyl)-2-(propan-2-ylamino)acetyl]pyrrolidin-2-yl]borinic acid (PubChem CID 163833541) has the molecular formula C17H33BN2O2 and a molecular weight of 308.27 g/mol. Its IUPAC name is methyl-[1-[2-(1-methylcyclohexyl)-2-(propan-2-ylamino)acetyl]pyrrolidin-2-yl]borinic acid.
| Compound Name | methyl-[1-[2-(1-methylcyclohexyl)-2-(propan-2-ylamino)acetyl]pyrrolidin-2-yl]borinic acid |
|---|---|
| PubChem CID | 163833541 |
| Molecular Formula | C17H33BN2O2 |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.26 |
| IUPAC Name | methyl-[1-[2-(1-methylcyclohexyl)-2-(propan-2-ylamino)acetyl]pyrrolidin-2-yl]borinic acid |
| SMILES | CB(O)C1CCCN1C(=O)C(NC(C)C)C1(C)CCCCC1 |
| InChI | InChI=1S/C17H33BN2O2/c1-13(2)19-15(17(3)10-6-5-7-11-17)16(21)20-12-8-9-14(20)18(4)22/h13-15,19,22H,5-12H2,1-4H3 |
| InChIKey | CNKJPESGNRZHIB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|