C14H20F3NO3 — CID 163837112
5-[[4-(trifluoromethyl)heptylamino]methyl]furan-2-carboxylic acid (PubChem CID 163837112) has the molecular formula C14H20F3NO3 and a molecular weight of 307.31 g/mol. Its IUPAC name is 5-[[4-(trifluoromethyl)heptylamino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[4-(trifluoromethyl)heptylamino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 163837112 |
| Molecular Formula | C14H20F3NO3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 5-[[4-(trifluoromethyl)heptylamino]methyl]furan-2-carboxylic acid |
| SMILES | CCCC(CCCNCc1ccc(C(=O)O)o1)C(F)(F)F |
| InChI | InChI=1S/C14H20F3NO3/c1-2-4-10(14(15,16)17)5-3-8-18-9-11-6-7-12(21-11)13(19)20/h6-7,10,18H,2-5,8-9H2,1H3,(H,19,20) |
| InChIKey | OISFJECADXSFJL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|