C28H31N3O4S — CID 163845467
3-[3-[(4-methoxyphenyl)sulfonyl-propylamino]propyl]-5-phenyl-1H-indole-7-carboxamide (PubChem CID 163845467) has the molecular formula C28H31N3O4S and a molecular weight of 505.64 g/mol. Its IUPAC name is 3-[3-[(4-methoxyphenyl)sulfonyl-propylamino]propyl]-5-phenyl-1H-indole-7-carboxamide.
| Compound Name | 3-[3-[(4-methoxyphenyl)sulfonyl-propylamino]propyl]-5-phenyl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 163845467 |
| Molecular Formula | C28H31N3O4S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 3-[3-[(4-methoxyphenyl)sulfonyl-propylamino]propyl]-5-phenyl-1H-indole-7-carboxamide |
| SMILES | CCCN(CCCc1c[nH]c2c(C(N)=O)cc(-c3ccccc3)cc12)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H31N3O4S/c1-3-15-31(36(33,34)24-13-11-23(35-2)12-14-24)16-7-10-21-19-30-27-25(21)17-22(18-26(27)28(29)32)20-8-5-4-6-9-20/h4-6,8-9,11-14,17-19,30H,3,7,10,15-16H2,1-2H3,(H2,29,32) |
| InChIKey | OPTGALSXYMPLRJ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |