C19H22IN3O — CID 86624137
(7-carbamoyl-5-phenyl-1H-indol-3-yl)methyl-trimethylazanium iodide (PubChem CID 86624137) has the molecular formula C19H22IN3O and a molecular weight of 435.31 g/mol. Its IUPAC name is (7-carbamoyl-5-phenyl-1H-indol-3-yl)methyl-trimethylazanium iodide.
| Compound Name | (7-carbamoyl-5-phenyl-1H-indol-3-yl)methyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 86624137 |
| Molecular Formula | C19H22IN3O |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | (7-carbamoyl-5-phenyl-1H-indol-3-yl)methyl-trimethylazanium iodide |
| SMILES | C[N+](C)(C)Cc1c[nH]c2c(C(N)=O)cc(-c3ccccc3)cc12.[I-] |
| InChI | InChI=1S/C19H21N3O.HI/c1-22(2,3)12-15-11-21-18-16(15)9-14(10-17(18)19(20)23)13-7-5-4-6-8-13;/h4-11H,12H2,1-3H3,(H2-,20,21,23);1H |
| InChIKey | CYKJQTOIEMNXQP-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|