C22H18N3O3S- — CID 174507717
[4-(7-carbamoyl-5-phenyl-1H-indol-3-yl)anilino]methanesulfinate (PubChem CID 174507717) has the molecular formula C22H18N3O3S- and a molecular weight of 404.47 g/mol. Its IUPAC name is [4-(7-carbamoyl-5-phenyl-1H-indol-3-yl)anilino]methanesulfinate.
| Compound Name | [4-(7-carbamoyl-5-phenyl-1H-indol-3-yl)anilino]methanesulfinate |
|---|---|
| PubChem CID | 174507717 |
| Molecular Formula | C22H18N3O3S- |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | [4-(7-carbamoyl-5-phenyl-1H-indol-3-yl)anilino]methanesulfinate |
| SMILES | NC(=O)c1cc(-c2ccccc2)cc2c(-c3ccc(NCS(=O)[O-])cc3)c[nH]c12 |
| InChI | InChI=1S/C22H19N3O3S/c23-22(26)19-11-16(14-4-2-1-3-5-14)10-18-20(12-24-21(18)19)15-6-8-17(9-7-15)25-13-29(27)28/h1-12,24-25H,13H2,(H2,23,26)(H,27,28)/p-1 |
| InChIKey | QOTNNRLDBQUKEA-UHFFFAOYSA-M |
| XLogP | 3.85 |
| TPSA | 111.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|