C24H26N2O3S — CID 11235547
3-[(4-ethylsulfonylcyclohexylidene)methyl]-5-phenyl-1H-indole-7-carboxamide (PubChem CID 11235547) has the molecular formula C24H26N2O3S and a molecular weight of 422.55 g/mol. Its IUPAC name is 3-[(4-ethylsulfonylcyclohexylidene)methyl]-5-phenyl-1H-indole-7-carboxamide.
| Compound Name | 3-[(4-ethylsulfonylcyclohexylidene)methyl]-5-phenyl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 11235547 |
| Molecular Formula | C24H26N2O3S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 3-[(4-ethylsulfonylcyclohexylidene)methyl]-5-phenyl-1H-indole-7-carboxamide |
| SMILES | CCS(=O)(=O)C1CCC(=Cc2c[nH]c3c(C(N)=O)cc(-c4ccccc4)cc23)CC1 |
| InChI | InChI=1S/C24H26N2O3S/c1-2-30(28,29)20-10-8-16(9-11-20)12-19-15-26-23-21(19)13-18(14-22(23)24(25)27)17-6-4-3-5-7-17/h3-7,12-15,20,26H,2,8-11H2,1H3,(H2,25,27)/b16-12- |
| InChIKey | LAGNAQKHRCNFEA-VBKFSLOCSA-N |
| XLogP | 4.69 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |