C19H23N — CID 163845764
4-[(E)-(6,6-dimethylcycloocta-2,4,7-trien-1-ylidene)methyl]-N,N-dimethylaniline (PubChem CID 163845764) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is 4-[(E)-(6,6-dimethylcycloocta-2,4,7-trien-1-ylidene)methyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-(6,6-dimethylcycloocta-2,4,7-trien-1-ylidene)methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 163845764 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 4-[(E)-(6,6-dimethylcycloocta-2,4,7-trien-1-ylidene)methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C2\C=CC=CC(C)(C)C=C2)cc1 |
| InChI | InChI=1S/C19H23N/c1-19(2)13-6-5-7-16(12-14-19)15-17-8-10-18(11-9-17)20(3)4/h5-15H,1-4H3/b7-5?,13-6?,14-12?,16-15+ |
| InChIKey | OPZVBPVVEZHJMF-LFWYNKLASA-N |
| XLogP | 4.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|