C20H21N4O4S+ — CID 163851625
CID 163851625 (PubChem CID 163851625) has the molecular formula C20H21N4O4S+ and a molecular weight of 413.48 g/mol.
| Compound Name | CID 163851625 |
|---|---|
| PubChem CID | 163851625 |
| Molecular Formula | C20H21N4O4S+ |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | — |
| SMILES | O=C(NCc1cccc([S+](=O)(O)NCCO)c1)c1cnc(-c2ccccc2)nc1 |
| InChI | InChI=1S/C20H20N4O4S/c25-10-9-24-29(27,28)18-8-4-5-15(11-18)12-23-20(26)17-13-21-19(22-14-17)16-6-2-1-3-7-16/h1-8,11,13-14,25H,9-10,12H2,(H2-,23,24,26,27,28)/p+1 |
| InChIKey | FTXMOONKWYTKCO-UHFFFAOYSA-O |
| XLogP | 1.90 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|