C34H36N4O5 — CID 163852798
2-[4-[[4-[2-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-2-oxoethyl]phenyl]methyl]-7-(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid (PubChem CID 163852798) has the molecular formula C34H36N4O5 and a molecular weight of 580.69 g/mol. Its IUPAC name is 2-[4-[[4-[2-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-2-oxoethyl]phenyl]methyl]-7-(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid.
| Compound Name | 2-[4-[[4-[2-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-2-oxoethyl]phenyl]methyl]-7-(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid |
|---|---|
| PubChem CID | 163852798 |
| Molecular Formula | C34H36N4O5 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.27 |
| IUPAC Name | 2-[4-[[4-[2-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-2-oxoethyl]phenyl]methyl]-7-(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(Cc2ccc(CC(=O)N3Cc4ccccc4C#Cc4ccccc43)cc2)CC1 |
| InChI | InChI=1S/C34H36N4O5/c39-32(38-23-30-7-2-1-5-28(30)13-14-29-6-3-4-8-31(29)38)21-26-9-11-27(12-10-26)22-35-15-17-36(24-33(40)41)19-20-37(18-16-35)25-34(42)43/h1-12H,15-25H2,(H,40,41)(H,42,43) |
| InChIKey | OVUAXKOJCBBMHR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|