About N'-ethoxy-N'-oxidomethanediamine
N'-ethoxy-N'-oxidomethanediamine (PubChem CID 163863648) has the molecular formula C3H9N2O2-
and a molecular weight of 105.12 g/mol. Its IUPAC name is N'-ethoxy-N'-oxidomethanediamine.
Molecular Properties
| Compound Name | N'-ethoxy-N'-oxidomethanediamine |
| PubChem CID | 163863648 |
| Molecular Formula | C3H9N2O2- |
| Molecular Weight | 105.12 g/mol |
| Exact Mass | 105.07 |
| IUPAC Name | N'-ethoxy-N'-oxidomethanediamine |
| SMILES | CCON([O-])CN |
| InChI | InChI=1S/C3H9N2O2/c1-2-7-5(6)3-4/h2-4H2,1H3/q-1 |
| InChIKey | BDWAJKTYGHIYSH-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.12 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-ethoxy-N'-oxidomethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethoxy-N'-oxidomethanediamine?
The IUPAC name of N'-ethoxy-N'-oxidomethanediamine (CID 163863648) is N'-ethoxy-N'-oxidomethanediamine.
What is the SMILES notation for N'-ethoxy-N'-oxidomethanediamine?
The canonical SMILES for N'-ethoxy-N'-oxidomethanediamine is CCON([O-])CN.
What is the InChIKey of N'-ethoxy-N'-oxidomethanediamine?
The InChIKey is BDWAJKTYGHIYSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N2O2/c1-2-7-5(6)3-4/h2-4H2,1H3/q-1.
What are the key properties of N'-ethoxy-N'-oxidomethanediamine?
N'-ethoxy-N'-oxidomethanediamine has a molecular weight of 105.12 g/mol, XLogP of -0.35, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethoxy-N'-oxidomethanediamine is sourced from PubChem (CID 163863648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).