C24H37ClN3O3+ — CID 163864112
4-amino-5-chloro-2-(cyclopropylmethoxy)-N-[1-[(4-hydroxy-1-methylpiperidin-1-ium-1-yl)methyl]cyclohexyl]benzamide (PubChem CID 163864112) has the molecular formula C24H37ClN3O3+ and a molecular weight of 451.03 g/mol. Its IUPAC name is 4-amino-5-chloro-2-(cyclopropylmethoxy)-N-[1-[(4-hydroxy-1-methylpiperidin-1-ium-1-yl)methyl]cyclohexyl]benzamide.
| Compound Name | 4-amino-5-chloro-2-(cyclopropylmethoxy)-N-[1-[(4-hydroxy-1-methylpiperidin-1-ium-1-yl)methyl]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 163864112 |
| Molecular Formula | C24H37ClN3O3+ |
| Molecular Weight | 451.03 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 4-amino-5-chloro-2-(cyclopropylmethoxy)-N-[1-[(4-hydroxy-1-methylpiperidin-1-ium-1-yl)methyl]cyclohexyl]benzamide |
| SMILES | C[N+]1(CC2(NC(=O)c3cc(Cl)c(N)cc3OCC3CC3)CCCCC2)CCC(O)CC1 |
| InChI | InChI=1S/C24H36ClN3O3/c1-28(11-7-18(29)8-12-28)16-24(9-3-2-4-10-24)27-23(30)19-13-20(25)21(26)14-22(19)31-15-17-5-6-17/h13-14,17-18,29H,2-12,15-16H2,1H3,(H2-,26,27,30)/p+1 |
| InChIKey | PFCWXOGKLHCTPB-UHFFFAOYSA-O |
| XLogP | 3.74 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.03 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|