C19H18FS+ — CID 163869609
(4-fluorophenyl)-(3-methylcyclohexa-1,5-dien-1-yl)-phenylsulfanium (PubChem CID 163869609) has the molecular formula C19H18FS+ and a molecular weight of 297.42 g/mol. Its IUPAC name is (4-fluorophenyl)-(3-methylcyclohexa-1,5-dien-1-yl)-phenylsulfanium.
| Compound Name | (4-fluorophenyl)-(3-methylcyclohexa-1,5-dien-1-yl)-phenylsulfanium |
|---|---|
| PubChem CID | 163869609 |
| Molecular Formula | C19H18FS+ |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | (4-fluorophenyl)-(3-methylcyclohexa-1,5-dien-1-yl)-phenylsulfanium |
| SMILES | CC1C=C([S+](c2ccccc2)c2ccc(F)cc2)C=CC1 |
| InChI | InChI=1S/C19H18FS/c1-15-6-5-9-19(14-15)21(17-7-3-2-4-8-17)18-12-10-16(20)11-13-18/h2-5,7-15H,6H2,1H3/q+1 |
| InChIKey | PJPYLBQZPXVJKK-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|