C13H16N2O4 — CID 163870989
1-[4-(2-methoxy-5-oxo-2H-pyrrol-1-yl)butyl]pyrrole-2,5-dione (PubChem CID 163870989) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 1-[4-(2-methoxy-5-oxo-2H-pyrrol-1-yl)butyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-(2-methoxy-5-oxo-2H-pyrrol-1-yl)butyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 163870989 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 1-[4-(2-methoxy-5-oxo-2H-pyrrol-1-yl)butyl]pyrrole-2,5-dione |
| SMILES | COC1C=CC(=O)N1CCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H16N2O4/c1-19-13-7-6-12(18)15(13)9-3-2-8-14-10(16)4-5-11(14)17/h4-7,13H,2-3,8-9H2,1H3 |
| InChIKey | PKTPUKQHHCCVDP-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|