C39H47NO11 — CID 163876235
[(3S,6R)-3,4-diacetyloxy-6-[2-acetyloxy-5-[[4-[(E)-3,3-dimethyl-4-oxo-4-(2-oxoethylideneamino)but-1-enyl]-2-methylphenyl]methyl]-4-propylphenyl]oxan-2-yl]methyl acetate (PubChem CID 163876235) has the molecular formula C39H47NO11 and a molecular weight of 705.80 g/mol. Its IUPAC name is [(3S,6R)-3,4-diacetyloxy-6-[2-acetyloxy-5-[[4-[(E)-3,3-dimethyl-4-oxo-4-(2-oxoethylideneamino)but-1-enyl]-2-methylphenyl]methyl]-4-propylphenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(3S,6R)-3,4-diacetyloxy-6-[2-acetyloxy-5-[[4-[(E)-3,3-dimethyl-4-oxo-4-(2-oxoethylideneamino)but-1-enyl]-2-methylphenyl]methyl]-4-propylphenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 163876235 |
| Molecular Formula | C39H47NO11 |
| Molecular Weight | 705.80 g/mol |
| Exact Mass | 705.31 |
| IUPAC Name | [(3S,6R)-3,4-diacetyloxy-6-[2-acetyloxy-5-[[4-[(E)-3,3-dimethyl-4-oxo-4-(2-oxoethylideneamino)but-1-enyl]-2-methylphenyl]methyl]-4-propylphenyl]oxan-2-yl]methyl acetate |
| SMILES | CCCc1cc(OC(C)=O)c([C@H]2CC(OC(C)=O)[C@H](OC(C)=O)C(COC(C)=O)O2)cc1Cc1ccc(/C=C/C(C)(C)C(=O)/N=C/C=O)cc1C |
| InChI | InChI=1S/C39H47NO11/c1-9-10-30-20-33(48-25(4)43)32(34-21-35(49-26(5)44)37(50-27(6)45)36(51-34)22-47-24(3)42)19-31(30)18-29-12-11-28(17-23(29)2)13-14-39(7,8)38(46)40-15-16-41/h11-17,19-20,34-37H,9-10,18,21-22H2,1-8H3/b14-13+,40-15+/t34-,35?,36?,37+/m1/s1 |
| InChIKey | PPCSJGHQHIHFSO-JOQVISIBSA-N |
| XLogP | 5.56 |
| TPSA | 160.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.80 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|