C17H23FN5O11P — CID 163881098
(3S)-3-[2-[(2R,3S,4R,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethoxy]-4-ethoxy-4-oxo-3-phosphonobutanoic acid (PubChem CID 163881098) has the molecular formula C17H23FN5O11P and a molecular weight of 523.37 g/mol. Its IUPAC name is (3S)-3-[2-[(2R,3S,4R,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethoxy]-4-ethoxy-4-oxo-3-phosphonobutanoic acid.
| Compound Name | (3S)-3-[2-[(2R,3S,4R,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethoxy]-4-ethoxy-4-oxo-3-phosphonobutanoic acid |
|---|---|
| PubChem CID | 163881098 |
| Molecular Formula | C17H23FN5O11P |
| Molecular Weight | 523.37 g/mol |
| Exact Mass | 523.11 |
| IUPAC Name | (3S)-3-[2-[(2R,3S,4R,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethoxy]-4-ethoxy-4-oxo-3-phosphonobutanoic acid |
| SMILES | CCOC(=O)[C@@](CC(=O)O)(OCC[C@H]1O[C@@H](n2cnc3c(N)nc(F)nc32)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C17H23FN5O11P/c1-2-32-15(28)17(5-8(24)25,35(29,30)31)33-4-3-7-10(26)11(27)14(34-7)23-6-20-9-12(19)21-16(18)22-13(9)23/h6-7,10-11,14,26-27H,2-5H2,1H3,(H,24,25)(H2,19,21,22)(H2,29,30,31)/t7-,10-,11-,14-,17+/m1/s1 |
| InChIKey | PTGKXGICFBKHPI-WRLMIJCQSA-N |
| XLogP | -1.51 |
| TPSA | 249.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.37 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|