C19H17Cl2N3O2 — CID 163881131
2-[[2,6-dichloro-3-[hydroxy(methoxy)methyl]phenyl]methyl]-3,7-dimethylbenzimidazole-5-carbonitrile (PubChem CID 163881131) has the molecular formula C19H17Cl2N3O2 and a molecular weight of 390.27 g/mol. Its IUPAC name is 2-[[2,6-dichloro-3-[hydroxy(methoxy)methyl]phenyl]methyl]-3,7-dimethylbenzimidazole-5-carbonitrile.
| Compound Name | 2-[[2,6-dichloro-3-[hydroxy(methoxy)methyl]phenyl]methyl]-3,7-dimethylbenzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 163881131 |
| Molecular Formula | C19H17Cl2N3O2 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 2-[[2,6-dichloro-3-[hydroxy(methoxy)methyl]phenyl]methyl]-3,7-dimethylbenzimidazole-5-carbonitrile |
| SMILES | COC(O)c1ccc(Cl)c(Cc2nc3c(C)cc(C#N)cc3n2C)c1Cl |
| InChI | InChI=1S/C19H17Cl2N3O2/c1-10-6-11(9-22)7-15-18(10)23-16(24(15)2)8-13-14(20)5-4-12(17(13)21)19(25)26-3/h4-7,19,25H,8H2,1-3H3 |
| InChIKey | PTHIIRFXSOMTAS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 71.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|