C16H31O4+ — CID 163890593
[(2R,3S,4S,5R)-2,5-dihydroxy-3-methoxy-5-methyl-4-[(E)-6-methylhept-2-en-2-yl]cyclohexyl]oxidanium (PubChem CID 163890593) has the molecular formula C16H31O4+ and a molecular weight of 287.42 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-2,5-dihydroxy-3-methoxy-5-methyl-4-[(E)-6-methylhept-2-en-2-yl]cyclohexyl]oxidanium.
| Compound Name | [(2R,3S,4S,5R)-2,5-dihydroxy-3-methoxy-5-methyl-4-[(E)-6-methylhept-2-en-2-yl]cyclohexyl]oxidanium |
|---|---|
| PubChem CID | 163890593 |
| Molecular Formula | C16H31O4+ |
| Molecular Weight | 287.42 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | [(2R,3S,4S,5R)-2,5-dihydroxy-3-methoxy-5-methyl-4-[(E)-6-methylhept-2-en-2-yl]cyclohexyl]oxidanium |
| SMILES | CO[C@@H]1[C@H](O)C([OH2+])C[C@@](C)(O)[C@H]1/C(C)=C/CCC(C)C |
| InChI | InChI=1S/C16H30O4/c1-10(2)7-6-8-11(3)13-15(20-5)14(18)12(17)9-16(13,4)19/h8,10,12-15,17-19H,6-7,9H2,1-5H3/p+1/b11-8+/t12?,13-,14+,15-,16+/m0/s1 |
| InChIKey | QBEWMUAGZXNWKQ-QOAMRRJPSA-O |
| XLogP | 1.61 |
| TPSA | 72.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|