C16H24O2 — CID 173179052
5-methoxy-6-(6-methylhept-2-en-2-yl)cyclohex-3-yne-1-carbaldehyde (PubChem CID 173179052) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 5-methoxy-6-(6-methylhept-2-en-2-yl)cyclohex-3-yne-1-carbaldehyde.
| Compound Name | 5-methoxy-6-(6-methylhept-2-en-2-yl)cyclohex-3-yne-1-carbaldehyde |
|---|---|
| PubChem CID | 173179052 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 5-methoxy-6-(6-methylhept-2-en-2-yl)cyclohex-3-yne-1-carbaldehyde |
| SMILES | COC1C#CCC(C=O)C1C(C)=CCCC(C)C |
| InChI | InChI=1S/C16H24O2/c1-12(2)7-5-8-13(3)16-14(11-17)9-6-10-15(16)18-4/h8,11-12,14-16H,5,7,9H2,1-4H3 |
| InChIKey | XNXWNMHXXGWTKM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|