C25H36O4 — CID 23523045
[7-ethyl-5-methoxy-4-[(E)-6-methylhept-2-en-2-yl]-1-oxaspiro[2.5]octan-6-yl] benzoate (PubChem CID 23523045) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is [7-ethyl-5-methoxy-4-[(E)-6-methylhept-2-en-2-yl]-1-oxaspiro[2.5]octan-6-yl] benzoate.
| Compound Name | [7-ethyl-5-methoxy-4-[(E)-6-methylhept-2-en-2-yl]-1-oxaspiro[2.5]octan-6-yl] benzoate |
|---|---|
| PubChem CID | 23523045 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | [7-ethyl-5-methoxy-4-[(E)-6-methylhept-2-en-2-yl]-1-oxaspiro[2.5]octan-6-yl] benzoate |
| SMILES | CCC1CC2(CO2)C(/C(C)=C/CCC(C)C)C(OC)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H36O4/c1-6-19-15-25(16-28-25)21(18(4)12-10-11-17(2)3)23(27-5)22(19)29-24(26)20-13-8-7-9-14-20/h7-9,12-14,17,19,21-23H,6,10-11,15-16H2,1-5H3/b18-12+ |
| InChIKey | QUMBCDVELQBXDO-LDADJPATSA-N |
| XLogP | 5.42 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|