C19H36O — CID 142143232
acetylene;1,1-dimethylcyclohexane;(6S)-6-methoxy-2-methylhept-2-ene (PubChem CID 142143232) has the molecular formula C19H36O and a molecular weight of 280.50 g/mol. Its IUPAC name is acetylene;1,1-dimethylcyclohexane;(6S)-6-methoxy-2-methylhept-2-ene.
| Compound Name | acetylene;1,1-dimethylcyclohexane;(6S)-6-methoxy-2-methylhept-2-ene |
|---|---|
| PubChem CID | 142143232 |
| Molecular Formula | C19H36O |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.28 |
| IUPAC Name | acetylene;1,1-dimethylcyclohexane;(6S)-6-methoxy-2-methylhept-2-ene |
| SMILES | C#C.CC1(C)CCCCC1.CO[C@@H](C)CCC=C(C)C |
| InChI | InChI=1S/C9H18O.C8H16.C2H2/c1-8(2)6-5-7-9(3)10-4;1-8(2)6-4-3-5-7-8;1-2/h6,9H,5,7H2,1-4H3;3-7H2,1-2H3;1-2H/t9-;;/m0../s1 |
| InChIKey | HDFVWQDTSLBOLR-WWPIYYJJSA-N |
| XLogP | 5.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|