C11H15N — CID 163891691
3-ethyl-1-methyl-3a,4-dihydroindole (PubChem CID 163891691) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 3-ethyl-1-methyl-3a,4-dihydroindole.
| Compound Name | 3-ethyl-1-methyl-3a,4-dihydroindole |
|---|---|
| PubChem CID | 163891691 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 3-ethyl-1-methyl-3a,4-dihydroindole |
| SMILES | CCC1=CN(C)C2=CC=CCC12 |
| InChI | InChI=1S/C11H15N/c1-3-9-8-12(2)11-7-5-4-6-10(9)11/h4-5,7-8,10H,3,6H2,1-2H3 |
| InChIKey | QCBNTCWGLIUUBD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |