C24H25BO3 — CID 163893733
2-[3-(5a,9a-dihydrodibenzofuran-1-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 163893733) has the molecular formula C24H25BO3 and a molecular weight of 372.27 g/mol. Its IUPAC name is 2-[3-(5a,9a-dihydrodibenzofuran-1-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-(5a,9a-dihydrodibenzofuran-1-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 163893733 |
| Molecular Formula | C24H25BO3 |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 2-[3-(5a,9a-dihydrodibenzofuran-1-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2cccc(-c3cccc4c3C3C=CC=CC3O4)c2)OC1(C)C |
| InChI | InChI=1S/C24H25BO3/c1-23(2)24(3,4)28-25(27-23)17-10-7-9-16(15-17)18-12-8-14-21-22(18)19-11-5-6-13-20(19)26-21/h5-15,19-20H,1-4H3 |
| InChIKey | QDTYQEDNLMRLAI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|