About ethane;methyl 10-oxo-9H-thioxanthene-4-carboxylate;methyl 9H-thioxanthene-4-carboxylate
ethane;methyl 10-oxo-9H-thioxanthene-4-carboxylate;methyl 9H-thioxanthene-4-carboxylate (PubChem CID 163908200) has the molecular formula C38H48O5S2
and a molecular weight of 648.93 g/mol. Its IUPAC name is ethane;methyl 10-oxo-9H-thioxanthene-4-carboxylate;methyl 9H-thioxanthene-4-carboxylate.
Molecular Properties
| Compound Name | ethane;methyl 10-oxo-9H-thioxanthene-4-carboxylate;methyl 9H-thioxanthene-4-carboxylate |
| PubChem CID | 163908200 |
| Molecular Formula | C38H48O5S2 |
| Molecular Weight | 648.93 g/mol |
| Exact Mass | 648.29 |
| IUPAC Name | ethane;methyl 10-oxo-9H-thioxanthene-4-carboxylate;methyl 9H-thioxanthene-4-carboxylate |
| SMILES | CC.CC.CC.CC.COC(=O)c1cccc2c1S(=O)c1ccccc1C2.COC(=O)c1cccc2c1Sc1ccccc1C2 |
| InChI | InChI=1S/C15H12O3S.C15H12O2S.4C2H6/c1-18-15(16)12-7-4-6-11-9-10-5-2-3-8-13(10)19(17)14(11)12;1-17-15(16)12-7-4-6-11-9-10-5-2-3-8-13(10)18-14(11)12;4*1-2/h2-8H,9H2,1H3;2-8H,9H2,1H3;4*1-2H3 |
| InChIKey | QPUNLZARRUUVIM-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 648.93 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethane;methyl 10-oxo-9H-thioxanthene-4-carboxylate;methyl 9H-thioxanthene-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 10-oxo-9H-thioxanthene-4-carboxylate;methyl 9H-thioxanthene-4-carboxylate?
The IUPAC name of ethane;methyl 10-oxo-9H-thioxanthene-4-carboxylate;methyl 9H-thioxanthene-4-carboxylate (CID 163908200) is ethane;methyl 10-oxo-9H-thioxanthene-4-carboxylate;methyl 9H-thioxanthene-4-carboxylate.
What is the SMILES notation for ethane;methyl 10-oxo-9H-thioxanthene-4-carboxylate;methyl 9H-thioxanthene-4-carboxylate?
The canonical SMILES for ethane;methyl 10-oxo-9H-thioxanthene-4-carboxylate;methyl 9H-thioxanthene-4-carboxylate is CC.CC.CC.CC.COC(=O)c1cccc2c1S(=O)c1ccccc1C2.COC(=O)c1cccc2c1Sc1ccccc1C2.
What is the InChIKey of ethane;methyl 10-oxo-9H-thioxanthene-4-carboxylate;methyl 9H-thioxanthene-4-carboxylate?
The InChIKey is QPUNLZARRUUVIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O3S.C15H12O2S.4C2H6/c1-18-15(16)12-7-4-6-11-9-10-5-2-3-8-13(10)19(17)14(11)12;1-17-15(16)12-7-4-6-11-9-10-5-2-3-8-13(10)18-14(11)12;4*1-2/h2-8H,9H2,1H3;2-8H,9H2,1H3;4*1-2H3.
What are the key properties of ethane;methyl 10-oxo-9H-thioxanthene-4-carboxylate;methyl 9H-thioxanthene-4-carboxylate?
ethane;methyl 10-oxo-9H-thioxanthene-4-carboxylate;methyl 9H-thioxanthene-4-carboxylate has a molecular weight of 648.93 g/mol, XLogP of 10.18, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 10-oxo-9H-thioxanthene-4-carboxylate;methyl 9H-thioxanthene-4-carboxylate is sourced from PubChem (CID 163908200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).