C22H16NO2S+ — CID 123842974
methyl 8-methyl-20-thia-8-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1,3,5,7,9,11,13(21),14,16,18-decaene-3-carboxylate (PubChem CID 123842974) has the molecular formula C22H16NO2S+ and a molecular weight of 358.44 g/mol. Its IUPAC name is methyl 8-methyl-20-thia-8-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1,3,5,7,9,11,13(21),14,16,18-decaene-3-carboxylate.
| Compound Name | methyl 8-methyl-20-thia-8-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1,3,5,7,9,11,13(21),14,16,18-decaene-3-carboxylate |
|---|---|
| PubChem CID | 123842974 |
| Molecular Formula | C22H16NO2S+ |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | methyl 8-methyl-20-thia-8-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1,3,5,7,9,11,13(21),14,16,18-decaene-3-carboxylate |
| SMILES | COC(=O)c1cccc2c1c1c3c(cccc3[n+]2C)-c2ccccc2S1 |
| InChI | InChI=1S/C22H16NO2S/c1-23-16-10-5-8-14-13-7-3-4-12-18(13)26-21(19(14)16)20-15(22(24)25-2)9-6-11-17(20)23/h3-12H,1-2H3/q+1 |
| InChIKey | XFJIDEDOVPVACI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|