C22H16ClNO2S — CID 86702567
(8-methyl-20-thia-8-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,8,10,12,14(19),15,17-decaen-16-yl) acetate chloride (PubChem CID 86702567) has the molecular formula C22H16ClNO2S and a molecular weight of 393.90 g/mol. Its IUPAC name is (8-methyl-20-thia-8-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,8,10,12,14(19),15,17-decaen-16-yl) acetate chloride.
| Compound Name | (8-methyl-20-thia-8-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,8,10,12,14(19),15,17-decaen-16-yl) acetate chloride |
|---|---|
| PubChem CID | 86702567 |
| Molecular Formula | C22H16ClNO2S |
| Molecular Weight | 393.90 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | (8-methyl-20-thia-8-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,8,10,12,14(19),15,17-decaen-16-yl) acetate chloride |
| SMILES | CC(=O)Oc1ccc2c(c1)-c1cccc3c1c(c1ccccc1[n+]3C)S2.[Cl-] |
| InChI | InChI=1S/C22H16NO2S.ClH/c1-13(24)25-14-10-11-20-17(12-14)15-7-5-9-19-21(15)22(26-20)16-6-3-4-8-18(16)23(19)2;/h3-12H,1-2H3;1H/q+1;/p-1 |
| InChIKey | MTHNUTCLESMKMT-UHFFFAOYSA-M |
| XLogP | 1.88 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.90 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|