C20H17NO3 — CID 163912922
4,14-dimethyl-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-2(7),3,5,9(19),10,12(20)-hexaene-13,15-dione (PubChem CID 163912922) has the molecular formula C20H17NO3 and a molecular weight of 319.36 g/mol. Its IUPAC name is 4,14-dimethyl-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-2(7),3,5,9(19),10,12(20)-hexaene-13,15-dione.
| Compound Name | 4,14-dimethyl-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-2(7),3,5,9(19),10,12(20)-hexaene-13,15-dione |
|---|---|
| PubChem CID | 163912922 |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 4,14-dimethyl-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-2(7),3,5,9(19),10,12(20)-hexaene-13,15-dione |
| SMILES | Cc1ccc2c(c1)C1CCC3C(=O)N(C)C(=O)c4ccc(c1c43)O2 |
| InChI | InChI=1S/C20H17NO3/c1-10-3-7-15-14(9-10)11-4-5-12-17-13(20(23)21(2)19(12)22)6-8-16(24-15)18(11)17/h3,6-9,11-12H,4-5H2,1-2H3 |
| InChIKey | QTSRRDPGZOMSQH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|