C18H18F3NO3S — CID 163913946
2,2-dimethyl-7-(sulfinoamino)-4-[4-(trifluoromethyl)phenyl]-6,7-dihydrochromene (PubChem CID 163913946) has the molecular formula C18H18F3NO3S and a molecular weight of 385.41 g/mol. Its IUPAC name is 2,2-dimethyl-7-(sulfinoamino)-4-[4-(trifluoromethyl)phenyl]-6,7-dihydrochromene.
| Compound Name | 2,2-dimethyl-7-(sulfinoamino)-4-[4-(trifluoromethyl)phenyl]-6,7-dihydrochromene |
|---|---|
| PubChem CID | 163913946 |
| Molecular Formula | C18H18F3NO3S |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 2,2-dimethyl-7-(sulfinoamino)-4-[4-(trifluoromethyl)phenyl]-6,7-dihydrochromene |
| SMILES | CC1(C)C=C(c2ccc(C(F)(F)F)cc2)C2=CCC(NS(=O)O)C=C2O1 |
| InChI | InChI=1S/C18H18F3NO3S/c1-17(2)10-15(11-3-5-12(6-4-11)18(19,20)21)14-8-7-13(22-26(23)24)9-16(14)25-17/h3-6,8-10,13,22H,7H2,1-2H3,(H,23,24) |
| InChIKey | LOAPONWNZXAOSS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|