C18H17F3NO3S- — CID 163913945
2,2-dimethyl-7-(sulfinatoamino)-4-[4-(trifluoromethyl)phenyl]-6,7-dihydrochromene (PubChem CID 163913945) has the molecular formula C18H17F3NO3S- and a molecular weight of 384.40 g/mol. Its IUPAC name is 2,2-dimethyl-7-(sulfinatoamino)-4-[4-(trifluoromethyl)phenyl]-6,7-dihydrochromene.
| Compound Name | 2,2-dimethyl-7-(sulfinatoamino)-4-[4-(trifluoromethyl)phenyl]-6,7-dihydrochromene |
|---|---|
| PubChem CID | 163913945 |
| Molecular Formula | C18H17F3NO3S- |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 2,2-dimethyl-7-(sulfinatoamino)-4-[4-(trifluoromethyl)phenyl]-6,7-dihydrochromene |
| SMILES | CC1(C)C=C(c2ccc(C(F)(F)F)cc2)C2=CCC(NS(=O)[O-])C=C2O1 |
| InChI | InChI=1S/C18H18F3NO3S/c1-17(2)10-15(11-3-5-12(6-4-11)18(19,20)21)14-8-7-13(22-26(23)24)9-16(14)25-17/h3-6,8-10,13,22H,7H2,1-2H3,(H,23,24)/p-1 |
| InChIKey | LOAPONWNZXAOSS-UHFFFAOYSA-M |
| XLogP | 3.86 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|