C18H16F3NO3S — CID 71243862
2,2-dimethyl-7-(sulfinoamino)-4-[4-(trifluoromethyl)phenyl]chromene (PubChem CID 71243862) has the molecular formula C18H16F3NO3S and a molecular weight of 383.39 g/mol. Its IUPAC name is 2,2-dimethyl-7-(sulfinoamino)-4-[4-(trifluoromethyl)phenyl]chromene.
| Compound Name | 2,2-dimethyl-7-(sulfinoamino)-4-[4-(trifluoromethyl)phenyl]chromene |
|---|---|
| PubChem CID | 71243862 |
| Molecular Formula | C18H16F3NO3S |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 2,2-dimethyl-7-(sulfinoamino)-4-[4-(trifluoromethyl)phenyl]chromene |
| SMILES | CC1(C)C=C(c2ccc(C(F)(F)F)cc2)c2ccc(NS(=O)O)cc2O1 |
| InChI | InChI=1S/C18H16F3NO3S/c1-17(2)10-15(11-3-5-12(6-4-11)18(19,20)21)14-8-7-13(22-26(23)24)9-16(14)25-17/h3-10,22H,1-2H3,(H,23,24) |
| InChIKey | WUKDKMBXEWCCTK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|