C14H13F3O — CID 11184358
(1S,2R)-2-methyl-4-[4-(trifluoromethyl)phenyl]cyclopent-3-ene-1-carbaldehyde (PubChem CID 11184358) has the molecular formula C14H13F3O and a molecular weight of 254.25 g/mol. Its IUPAC name is (1S,2R)-2-methyl-4-[4-(trifluoromethyl)phenyl]cyclopent-3-ene-1-carbaldehyde.
| Compound Name | (1S,2R)-2-methyl-4-[4-(trifluoromethyl)phenyl]cyclopent-3-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 11184358 |
| Molecular Formula | C14H13F3O |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | (1S,2R)-2-methyl-4-[4-(trifluoromethyl)phenyl]cyclopent-3-ene-1-carbaldehyde |
| SMILES | C[C@@H]1C=C(c2ccc(C(F)(F)F)cc2)C[C@@H]1C=O |
| InChI | InChI=1S/C14H13F3O/c1-9-6-11(7-12(9)8-18)10-2-4-13(5-3-10)14(15,16)17/h2-6,8-9,12H,7H2,1H3/t9-,12-/m1/s1 |
| InChIKey | XUZNZAWCNGBQPP-BXKDBHETSA-N |
| XLogP | 3.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|