C17H24F3IN- — CID 163917926
CID 163917926 (PubChem CID 163917926) has the molecular formula C17H24F3IN- and a molecular weight of 426.28 g/mol.
| Compound Name | CID 163917926 |
|---|---|
| PubChem CID | 163917926 |
| Molecular Formula | C17H24F3IN- |
| Molecular Weight | 426.28 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | — |
| SMILES | CC(C)c1ccc(CC2CCN(C)CC[I-]2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H24F3IN/c1-12(2)13-4-5-14(16(11-13)17(18,19)20)10-15-6-8-22(3)9-7-21-15/h4-5,11-12,15H,6-10H2,1-3H3/q-1 |
| InChIKey | WGABCALRCISVMI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|