C16H22N2O2 — CID 163922660
5-benzyl-1'-methylspiro[2,7-dioxa-5-azabicyclo[4.1.0]heptane-3,4'-piperidine] (PubChem CID 163922660) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 5-benzyl-1'-methylspiro[2,7-dioxa-5-azabicyclo[4.1.0]heptane-3,4'-piperidine].
| Compound Name | 5-benzyl-1'-methylspiro[2,7-dioxa-5-azabicyclo[4.1.0]heptane-3,4'-piperidine] |
|---|---|
| PubChem CID | 163922660 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 5-benzyl-1'-methylspiro[2,7-dioxa-5-azabicyclo[4.1.0]heptane-3,4'-piperidine] |
| SMILES | CN1CCC2(CC1)CN(Cc1ccccc1)C1OC1O2 |
| InChI | InChI=1S/C16H22N2O2/c1-17-9-7-16(8-10-17)12-18(14-15(19-14)20-16)11-13-5-3-2-4-6-13/h2-6,14-15H,7-12H2,1H3 |
| InChIKey | RBTRFXHKKZVQSI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 28.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|