C27H28N2O7S — CID 163925634
[4-[2-[(2-methoxybenzoyl)amino]ethyl]-4-thiophen-2-ylcyclohexyl] (4-nitrophenyl) carbonate (PubChem CID 163925634) has the molecular formula C27H28N2O7S and a molecular weight of 524.60 g/mol. Its IUPAC name is [4-[2-[(2-methoxybenzoyl)amino]ethyl]-4-thiophen-2-ylcyclohexyl] (4-nitrophenyl) carbonate.
| Compound Name | [4-[2-[(2-methoxybenzoyl)amino]ethyl]-4-thiophen-2-ylcyclohexyl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 163925634 |
| Molecular Formula | C27H28N2O7S |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | [4-[2-[(2-methoxybenzoyl)amino]ethyl]-4-thiophen-2-ylcyclohexyl] (4-nitrophenyl) carbonate |
| SMILES | COc1ccccc1C(=O)NCCC1(c2cccs2)CCC(OC(=O)Oc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C27H28N2O7S/c1-34-23-6-3-2-5-22(23)25(30)28-17-16-27(24-7-4-18-37-24)14-12-21(13-15-27)36-26(31)35-20-10-8-19(9-11-20)29(32)33/h2-11,18,21H,12-17H2,1H3,(H,28,30) |
| InChIKey | REFUQRQOJHTLRH-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|