C24H27N3O3S — CID 163932272
(1R,9R,14R,18S,19R,20S)-19-methoxy-14,20-dimethyl-23-oxo-11-sulfanylidene-15-oxa-10,12-diazahexacyclo[16.3.1.19,12.01,9.03,8.014,17]tricosa-3(8),4,6-triene-6-carbonitrile (PubChem CID 163932272) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is (1R,9R,14R,18S,19R,20S)-19-methoxy-14,20-dimethyl-23-oxo-11-sulfanylidene-15-oxa-10,12-diazahexacyclo[16.3.1.19,12.01,9.03,8.014,17]tricosa-3(8),4,6-triene-6-carbonitrile.
| Compound Name | (1R,9R,14R,18S,19R,20S)-19-methoxy-14,20-dimethyl-23-oxo-11-sulfanylidene-15-oxa-10,12-diazahexacyclo[16.3.1.19,12.01,9.03,8.014,17]tricosa-3(8),4,6-triene-6-carbonitrile |
|---|---|
| PubChem CID | 163932272 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | (1R,9R,14R,18S,19R,20S)-19-methoxy-14,20-dimethyl-23-oxo-11-sulfanylidene-15-oxa-10,12-diazahexacyclo[16.3.1.19,12.01,9.03,8.014,17]tricosa-3(8),4,6-triene-6-carbonitrile |
| SMILES | CO[C@@H]1[C@@H](C)C[C@@]23Cc4ccc(C#N)cc4[C@]24NC(=S)N(C[C@]2(C)OCC2[C@@H]1C3)C4=O |
| InChI | InChI=1S/C24H27N3O3S/c1-13-7-23-8-15-5-4-14(10-25)6-17(15)24(23)20(28)27(21(31)26-24)12-22(2)18(11-30-22)16(9-23)19(13)29-3/h4-6,13,16,18-19H,7-9,11-12H2,1-3H3,(H,26,31)/t13-,16-,18?,19+,22-,23-,24+/m0/s1 |
| InChIKey | RJRNUYUKIHOSEZ-SFSACYJKSA-N |
| XLogP | 2.49 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|