C26H39Cl2N5O4S — CID 163940074
2,6-dichloro-N-[(3R)-3-[4-[2-methoxyethoxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-4,4-dimethyl-3H-pyridine-5-carboxamide (PubChem CID 163940074) has the molecular formula C26H39Cl2N5O4S and a molecular weight of 588.60 g/mol. Its IUPAC name is 2,6-dichloro-N-[(3R)-3-[4-[2-methoxyethoxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-4,4-dimethyl-3H-pyridine-5-carboxamide.
| Compound Name | 2,6-dichloro-N-[(3R)-3-[4-[2-methoxyethoxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-4,4-dimethyl-3H-pyridine-5-carboxamide |
|---|---|
| PubChem CID | 163940074 |
| Molecular Formula | C26H39Cl2N5O4S |
| Molecular Weight | 588.60 g/mol |
| Exact Mass | 587.21 |
| IUPAC Name | 2,6-dichloro-N-[(3R)-3-[4-[2-methoxyethoxycarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-4,4-dimethyl-3H-pyridine-5-carboxamide |
| SMILES | COCCONC(=O)N(Cc1ccsc1)C1CCN([C@H](C)CCNC(=O)C2=C(Cl)N=C(Cl)CC2(C)C)CC1 |
| InChI | InChI=1S/C26H39Cl2N5O4S/c1-18(5-9-29-24(34)22-23(28)30-21(27)15-26(22,2)3)32-10-6-20(7-11-32)33(16-19-8-14-38-17-19)25(35)31-37-13-12-36-4/h8,14,17-18,20H,5-7,9-13,15-16H2,1-4H3,(H,29,34)(H,31,35)/t18-/m1/s1 |
| InChIKey | RQFZSADCPBKXNL-GOSISDBHSA-N |
| XLogP | 4.71 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|