C29H21N3O5 — CID 163940613
4-[(2S,6S,7R,9S)-1-[2-(4-cyanophenoxy)ethyl]-9-hydroxy-3,5-dioxo-11-oxa-4-azatetracyclo[6.2.1.02,6.02,7]undecan-4-yl]naphthalene-1-carbonitrile (PubChem CID 163940613) has the molecular formula C29H21N3O5 and a molecular weight of 491.50 g/mol. Its IUPAC name is 4-[(2S,6S,7R,9S)-1-[2-(4-cyanophenoxy)ethyl]-9-hydroxy-3,5-dioxo-11-oxa-4-azatetracyclo[6.2.1.02,6.02,7]undecan-4-yl]naphthalene-1-carbonitrile.
| Compound Name | 4-[(2S,6S,7R,9S)-1-[2-(4-cyanophenoxy)ethyl]-9-hydroxy-3,5-dioxo-11-oxa-4-azatetracyclo[6.2.1.02,6.02,7]undecan-4-yl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 163940613 |
| Molecular Formula | C29H21N3O5 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | 4-[(2S,6S,7R,9S)-1-[2-(4-cyanophenoxy)ethyl]-9-hydroxy-3,5-dioxo-11-oxa-4-azatetracyclo[6.2.1.02,6.02,7]undecan-4-yl]naphthalene-1-carbonitrile |
| SMILES | N#Cc1ccc(OCCC23C[C@H](O)C(O2)[C@@H]2[C@@H]4C(=O)N(c5ccc(C#N)c6ccccc56)C(=O)[C@@]243)cc1 |
| InChI | InChI=1S/C29H21N3O5/c30-14-16-5-8-18(9-6-16)36-12-11-28-13-22(33)25(37-28)23-24-26(34)32(27(35)29(23,24)28)21-10-7-17(15-31)19-3-1-2-4-20(19)21/h1-10,22-25,33H,11-13H2/t22-,23-,24+,25?,28?,29+/m0/s1 |
| InChIKey | RQQUDDITVCRRNH-WIONCPEASA-N |
| XLogP | 3.06 |
| TPSA | 123.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|