C24H24N2O5S — CID 89194625
4-[(3aR,5S,7aS)-4-ethyl-5-methoxy-1,3-dioxo-7-(2-sulfanyloxyethyl)-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile (PubChem CID 89194625) has the molecular formula C24H24N2O5S and a molecular weight of 452.53 g/mol. Its IUPAC name is 4-[(3aR,5S,7aS)-4-ethyl-5-methoxy-1,3-dioxo-7-(2-sulfanyloxyethyl)-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile.
| Compound Name | 4-[(3aR,5S,7aS)-4-ethyl-5-methoxy-1,3-dioxo-7-(2-sulfanyloxyethyl)-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 89194625 |
| Molecular Formula | C24H24N2O5S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 4-[(3aR,5S,7aS)-4-ethyl-5-methoxy-1,3-dioxo-7-(2-sulfanyloxyethyl)-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
| SMILES | CCC12OC(CCOS)(C[C@@H]1OC)[C@H]1C(=O)N(c3ccc(C#N)c4ccccc34)C(=O)[C@H]12 |
| InChI | InChI=1S/C24H24N2O5S/c1-3-24-18(29-2)12-23(31-24,10-11-30-32)19-20(24)22(28)26(21(19)27)17-9-8-14(13-25)15-6-4-5-7-16(15)17/h4-9,18-20,32H,3,10-12H2,1-2H3/t18-,19+,20-,23?,24?/m0/s1 |
| InChIKey | BWHHCMCFNJQUBI-CAEZZUPXSA-N |
| XLogP | 3.41 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|