C24H22N2O4S — CID 89194593
4-[(2R,6S,8R,10S)-1-ethyl-3,5-dioxo-7-(2-sulfanyloxyethyl)-11-oxa-4-azatetracyclo[5.3.1.02,6.08,10]undecan-4-yl]naphthalene-1-carbonitrile (PubChem CID 89194593) has the molecular formula C24H22N2O4S and a molecular weight of 434.52 g/mol. Its IUPAC name is 4-[(2R,6S,8R,10S)-1-ethyl-3,5-dioxo-7-(2-sulfanyloxyethyl)-11-oxa-4-azatetracyclo[5.3.1.02,6.08,10]undecan-4-yl]naphthalene-1-carbonitrile.
| Compound Name | 4-[(2R,6S,8R,10S)-1-ethyl-3,5-dioxo-7-(2-sulfanyloxyethyl)-11-oxa-4-azatetracyclo[5.3.1.02,6.08,10]undecan-4-yl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 89194593 |
| Molecular Formula | C24H22N2O4S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 4-[(2R,6S,8R,10S)-1-ethyl-3,5-dioxo-7-(2-sulfanyloxyethyl)-11-oxa-4-azatetracyclo[5.3.1.02,6.08,10]undecan-4-yl]naphthalene-1-carbonitrile |
| SMILES | CCC12OC(CCOS)([C@@H]3C[C@@H]31)[C@H]1C(=O)N(c3ccc(C#N)c4ccccc34)C(=O)[C@H]12 |
| InChI | InChI=1S/C24H22N2O4S/c1-2-23-16-11-17(16)24(30-23,9-10-29-31)20-19(23)21(27)26(22(20)28)18-8-7-13(12-25)14-5-3-4-6-15(14)18/h3-8,16-17,19-20,31H,2,9-11H2,1H3/t16-,17+,19-,20+,23?,24?/m0/s1 |
| InChIKey | NREJRNOSPUQRKV-ZRMSABOTSA-N |
| XLogP | 3.64 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|