C30H28N2O4 — CID 68906763
4-[(3aS,4S,7S,7aR)-4-[2-(2,3-dimethylphenoxy)ethyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile (PubChem CID 68906763) has the molecular formula C30H28N2O4 and a molecular weight of 480.56 g/mol. Its IUPAC name is 4-[(3aS,4S,7S,7aR)-4-[2-(2,3-dimethylphenoxy)ethyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile.
| Compound Name | 4-[(3aS,4S,7S,7aR)-4-[2-(2,3-dimethylphenoxy)ethyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 68906763 |
| Molecular Formula | C30H28N2O4 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 4-[(3aS,4S,7S,7aR)-4-[2-(2,3-dimethylphenoxy)ethyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
| SMILES | Cc1cccc(OCC[C@]23CC[C@](C)(O2)[C@@H]2C(=O)N(c4ccc(C#N)c5ccccc45)C(=O)[C@@H]23)c1C |
| InChI | InChI=1S/C30H28N2O4/c1-18-7-6-10-24(19(18)2)35-16-15-30-14-13-29(3,36-30)25-26(30)28(34)32(27(25)33)23-12-11-20(17-31)21-8-4-5-9-22(21)23/h4-12,25-26H,13-16H2,1-3H3/t25-,26+,29-,30-/m0/s1 |
| InChIKey | UWWQNOYMSRLDGR-ZDIDPRFDSA-N |
| XLogP | 5.22 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|