C28H21N3O4 — CID 70917478
4-[(3aR,7aS)-4-(1,3-benzoxazol-2-ylmethyl)-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile (PubChem CID 70917478) has the molecular formula C28H21N3O4 and a molecular weight of 463.49 g/mol. Its IUPAC name is 4-[(3aR,7aS)-4-(1,3-benzoxazol-2-ylmethyl)-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile.
| Compound Name | 4-[(3aR,7aS)-4-(1,3-benzoxazol-2-ylmethyl)-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 70917478 |
| Molecular Formula | C28H21N3O4 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | 4-[(3aR,7aS)-4-(1,3-benzoxazol-2-ylmethyl)-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
| SMILES | CC12CCC(Cc3nc4ccccc4o3)(O1)[C@@H]1C(=O)N(c3ccc(C#N)c4ccccc34)C(=O)[C@@H]12 |
| InChI | InChI=1S/C28H21N3O4/c1-27-12-13-28(35-27,14-22-30-19-8-4-5-9-21(19)34-22)24-23(27)25(32)31(26(24)33)20-11-10-16(15-29)17-6-2-3-7-18(17)20/h2-11,23-24H,12-14H2,1H3/t23-,24+,27?,28?/m1/s1 |
| InChIKey | WPJIZJGUTALLNO-JRFXRKNHSA-N |
| XLogP | 4.52 |
| TPSA | 96.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|