C28H27N5O3 — CID 142266791
4-[(3aR,4S,7R,7aS)-4-[3-(6-amino-2-methylpyrimidin-4-yl)propyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile (PubChem CID 142266791) has the molecular formula C28H27N5O3 and a molecular weight of 481.56 g/mol. Its IUPAC name is 4-[(3aR,4S,7R,7aS)-4-[3-(6-amino-2-methylpyrimidin-4-yl)propyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile.
| Compound Name | 4-[(3aR,4S,7R,7aS)-4-[3-(6-amino-2-methylpyrimidin-4-yl)propyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 142266791 |
| Molecular Formula | C28H27N5O3 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 4-[(3aR,4S,7R,7aS)-4-[3-(6-amino-2-methylpyrimidin-4-yl)propyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
| SMILES | Cc1nc(N)cc(CCC[C@@]23CC[C@@](C)(O2)[C@H]2C(=O)N(c4ccc(C#N)c5ccccc45)C(=O)[C@H]23)n1 |
| InChI | InChI=1S/C28H27N5O3/c1-16-31-18(14-22(30)32-16)6-5-11-28-13-12-27(2,36-28)23-24(28)26(35)33(25(23)34)21-10-9-17(15-29)19-7-3-4-8-20(19)21/h3-4,7-10,14,23-24H,5-6,11-13H2,1-2H3,(H2,30,31,32)/t23-,24+,27-,28+/m1/s1 |
| InChIKey | OBPWPLJGABQISN-CUFBHMEESA-N |
| XLogP | 3.84 |
| TPSA | 122.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|