C29H23N5O6 — CID 71046087
4-[(3aS,7aR)-4-methyl-7-[2-[(6-nitro-1H-indazol-3-yl)oxy]ethyl]-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile (PubChem CID 71046087) has the molecular formula C29H23N5O6 and a molecular weight of 537.53 g/mol. Its IUPAC name is 4-[(3aS,7aR)-4-methyl-7-[2-[(6-nitro-1H-indazol-3-yl)oxy]ethyl]-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile.
| Compound Name | 4-[(3aS,7aR)-4-methyl-7-[2-[(6-nitro-1H-indazol-3-yl)oxy]ethyl]-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 71046087 |
| Molecular Formula | C29H23N5O6 |
| Molecular Weight | 537.53 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | 4-[(3aS,7aR)-4-methyl-7-[2-[(6-nitro-1H-indazol-3-yl)oxy]ethyl]-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
| SMILES | CC12CCC(CCOc3n[nH]c4cc([N+](=O)[O-])ccc34)(O1)[C@@H]1C(=O)N(c3ccc(C#N)c4ccccc34)C(=O)[C@@H]12 |
| InChI | InChI=1S/C29H23N5O6/c1-28-10-11-29(40-28,12-13-39-25-20-8-7-17(34(37)38)14-21(20)31-32-25)24-23(28)26(35)33(27(24)36)22-9-6-16(15-30)18-4-2-3-5-19(18)22/h2-9,14,23-24H,10-13H2,1H3,(H,31,32)/t23-,24+,28?,29?/m1/s1 |
| InChIKey | FYANVQSOPMAUMW-BQGZWFRWSA-N |
| XLogP | 4.39 |
| TPSA | 151.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|