C14H19F3O3 — CID 163940985
[3-ethenoxy-3-methyl-6-(trifluoromethyl)-6-bicyclo[3.2.1]octanyl] acetate (PubChem CID 163940985) has the molecular formula C14H19F3O3 and a molecular weight of 292.30 g/mol. Its IUPAC name is [3-ethenoxy-3-methyl-6-(trifluoromethyl)-6-bicyclo[3.2.1]octanyl] acetate.
| Compound Name | [3-ethenoxy-3-methyl-6-(trifluoromethyl)-6-bicyclo[3.2.1]octanyl] acetate |
|---|---|
| PubChem CID | 163940985 |
| Molecular Formula | C14H19F3O3 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | [3-ethenoxy-3-methyl-6-(trifluoromethyl)-6-bicyclo[3.2.1]octanyl] acetate |
| SMILES | C=COC1(C)CC2CC(C1)C(OC(C)=O)(C(F)(F)F)C2 |
| InChI | InChI=1S/C14H19F3O3/c1-4-19-12(3)6-10-5-11(8-12)13(7-10,14(15,16)17)20-9(2)18/h4,10-11H,1,5-8H2,2-3H3 |
| InChIKey | RQXYNCBKKBFFGY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|