C16H23NO2 — CID 163949892
6-(1-bicyclo[3.2.0]heptanyl)-6-methyl-4,5,7,7a-tetrahydro-3aH-isoindole-1,3-dione (PubChem CID 163949892) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 6-(1-bicyclo[3.2.0]heptanyl)-6-methyl-4,5,7,7a-tetrahydro-3aH-isoindole-1,3-dione.
| Compound Name | 6-(1-bicyclo[3.2.0]heptanyl)-6-methyl-4,5,7,7a-tetrahydro-3aH-isoindole-1,3-dione |
|---|---|
| PubChem CID | 163949892 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 6-(1-bicyclo[3.2.0]heptanyl)-6-methyl-4,5,7,7a-tetrahydro-3aH-isoindole-1,3-dione |
| SMILES | CC1(C23CCCC2CC3)CCC2C(=O)NC(=O)C2C1 |
| InChI | InChI=1S/C16H23NO2/c1-15(16-6-2-3-10(16)4-8-16)7-5-11-12(9-15)14(19)17-13(11)18/h10-12H,2-9H2,1H3,(H,17,18,19) |
| InChIKey | RYJWKCMCGXWWTJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|