C14H23NO2 — CID 123805396
4-tert-butyl-5,5-dimethyl-4a,6,7,7a-tetrahydro-4H-cyclopenta[c]pyridine-1,3-dione (PubChem CID 123805396) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is 4-tert-butyl-5,5-dimethyl-4a,6,7,7a-tetrahydro-4H-cyclopenta[c]pyridine-1,3-dione.
| Compound Name | 4-tert-butyl-5,5-dimethyl-4a,6,7,7a-tetrahydro-4H-cyclopenta[c]pyridine-1,3-dione |
|---|---|
| PubChem CID | 123805396 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 4-tert-butyl-5,5-dimethyl-4a,6,7,7a-tetrahydro-4H-cyclopenta[c]pyridine-1,3-dione |
| SMILES | CC(C)(C)C1C(=O)NC(=O)C2CCC(C)(C)C21 |
| InChI | InChI=1S/C14H23NO2/c1-13(2,3)10-9-8(6-7-14(9,4)5)11(16)15-12(10)17/h8-10H,6-7H2,1-5H3,(H,15,16,17) |
| InChIKey | GGHYUFSVVSAMQP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|