C13H18N4O3S — CID 163959296
N-[4-[(4-amino-2-oxo-1H-2λ4,1,3-benzothiadiazin-5-yl)oxy]butyl]acetamide (PubChem CID 163959296) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is N-[4-[(4-amino-2-oxo-1H-2λ4,1,3-benzothiadiazin-5-yl)oxy]butyl]acetamide.
| Compound Name | N-[4-[(4-amino-2-oxo-1H-2λ4,1,3-benzothiadiazin-5-yl)oxy]butyl]acetamide |
|---|---|
| PubChem CID | 163959296 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | N-[4-[(4-amino-2-oxo-1H-2λ4,1,3-benzothiadiazin-5-yl)oxy]butyl]acetamide |
| SMILES | CC(=O)NCCCCOc1cccc2c1C(N)=NS(=O)N2 |
| InChI | InChI=1S/C13H18N4O3S/c1-9(18)15-7-2-3-8-20-11-6-4-5-10-12(11)13(14)17-21(19)16-10/h4-6,16H,2-3,7-8H2,1H3,(H2,14,17)(H,15,18) |
| InChIKey | SGCVDJAPRFIUDZ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|