C12H19N2U- — CID 163961556
2-[(2S)-2-methylbutyl]-1,3,3a,7a-tetrahydroindazole;uranium (PubChem CID 163961556) has the molecular formula C12H19N2U- and a molecular weight of 429.33 g/mol. Its IUPAC name is 2-[(2S)-2-methylbutyl]-1,3,3a,7a-tetrahydroindazole;uranium.
| Compound Name | 2-[(2S)-2-methylbutyl]-1,3,3a,7a-tetrahydroindazole;uranium |
|---|---|
| PubChem CID | 163961556 |
| Molecular Formula | C12H19N2U- |
| Molecular Weight | 429.33 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 2-[(2S)-2-methylbutyl]-1,3,3a,7a-tetrahydroindazole;uranium |
| SMILES | C[CH-][C@H](C)CN1CC2C=CC=CC2N1.[U] |
| InChI | InChI=1S/C12H19N2.U/c1-3-10(2)8-14-9-11-6-4-5-7-12(11)13-14;/h3-7,10-13H,8-9H2,1-2H3;/q-1;/t10-,11?,12?;/m0./s1 |
| InChIKey | HHSLOPVYHOTLGR-YGKYINHESA-N |
| XLogP | 1.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|