C13H21N3 — CID 176569570
3-[(3R)-3-methyl-1,2,3,6-tetrahydropyridin-5-yl]-1,2,3,3a,6,7-hexahydropyrazolo[1,5-a]pyridine (PubChem CID 176569570) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 3-[(3R)-3-methyl-1,2,3,6-tetrahydropyridin-5-yl]-1,2,3,3a,6,7-hexahydropyrazolo[1,5-a]pyridine.
| Compound Name | 3-[(3R)-3-methyl-1,2,3,6-tetrahydropyridin-5-yl]-1,2,3,3a,6,7-hexahydropyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 176569570 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 3-[(3R)-3-methyl-1,2,3,6-tetrahydropyridin-5-yl]-1,2,3,3a,6,7-hexahydropyrazolo[1,5-a]pyridine |
| SMILES | C[C@@H]1C=C(C2CNN3CCC=CC23)CNC1 |
| InChI | InChI=1S/C13H21N3/c1-10-6-11(8-14-7-10)12-9-15-16-5-3-2-4-13(12)16/h2,4,6,10,12-15H,3,5,7-9H2,1H3/t10-,12?,13?/m1/s1 |
| InChIKey | WPHDOPIBWVVPAB-QFWMXSHPSA-N |
| XLogP | 0.92 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|