C16H11NO4S — CID 163962741
5-(benzenesulfinyl)-[1,3]dioxolo[4,5-f]indole-7-carbaldehyde (PubChem CID 163962741) has the molecular formula C16H11NO4S and a molecular weight of 313.33 g/mol. Its IUPAC name is 5-(benzenesulfinyl)-[1,3]dioxolo[4,5-f]indole-7-carbaldehyde.
| Compound Name | 5-(benzenesulfinyl)-[1,3]dioxolo[4,5-f]indole-7-carbaldehyde |
|---|---|
| PubChem CID | 163962741 |
| Molecular Formula | C16H11NO4S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 5-(benzenesulfinyl)-[1,3]dioxolo[4,5-f]indole-7-carbaldehyde |
| SMILES | O=Cc1cn(S(=O)c2ccccc2)c2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C16H11NO4S/c18-9-11-8-17(22(19)12-4-2-1-3-5-12)14-7-16-15(6-13(11)14)20-10-21-16/h1-9H,10H2 |
| InChIKey | SIYPGRFLCIPIJT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|