C48H56IN12O4- — CID 163963402
CID 163963402 (PubChem CID 163963402) has the molecular formula C48H56IN12O4- and a molecular weight of 991.96 g/mol.
| Compound Name | CID 163963402 |
|---|---|
| PubChem CID | 163963402 |
| Molecular Formula | C48H56IN12O4- |
| Molecular Weight | 991.96 g/mol |
| Exact Mass | 991.36 |
| IUPAC Name | — |
| SMILES | Cc1cc(Nc2nc(Nc3ccc(OCCO)cc3)nc(N3CCCCC3)n2)ccc1/C=C/c1ccc(Nc2nc(Nc3ccc(OCCO[IH-])cc3)nc(N3CCCCC3)n2)cc1C |
| InChI | InChI=1S/C48H55IN12O4/c1-33-31-39(52-45-54-43(56-47(58-45)60-23-5-3-6-24-60)50-37-15-19-41(20-16-37)63-28-27-62)13-11-35(33)9-10-36-12-14-40(32-34(36)2)53-46-55-44(57-48(59-46)61-25-7-4-8-26-61)51-38-17-21-42(22-18-38)64-29-30-65-49/h9-22,31-32,62H,3-8,23-30H2,1-2H3,(H2,50,52,54,56,58)(H2,51,53,55,57,59)/q-1/b10-9+ |
| InChIKey | DEINWRGWFHKSGM-MDZDMXLPSA-N |
| XLogP | 5.77 |
| TPSA | 179.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 991.96 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|